C37H26F6N2O2S2 — CID 102524611
2-[2-[4-[3,3,4,4,5,5-hexafluoro-2-[5-[(E)-2-(8-hydroxyquinolin-2-yl)ethenyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]ethyl]quinolin-8-ol (PubChem CID 102524611) has the molecular formula C37H26F6N2O2S2 and a molecular weight of 708.75 g/mol. Its IUPAC name is 2-[2-[4-[3,3,4,4,5,5-hexafluoro-2-[5-[(E)-2-(8-hydroxyquinolin-2-yl)ethenyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]ethyl]quinolin-8-ol.
| Compound Name | 2-[2-[4-[3,3,4,4,5,5-hexafluoro-2-[5-[(E)-2-(8-hydroxyquinolin-2-yl)ethenyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]ethyl]quinolin-8-ol |
|---|---|
| PubChem CID | 102524611 |
| Molecular Formula | C37H26F6N2O2S2 |
| Molecular Weight | 708.75 g/mol |
| Exact Mass | 708.13 |
| IUPAC Name | 2-[2-[4-[3,3,4,4,5,5-hexafluoro-2-[5-[(E)-2-(8-hydroxyquinolin-2-yl)ethenyl]-2-methylthiophen-3-yl]cyclopenten-1-yl]-5-methylthiophen-2-yl]ethyl]quinolin-8-ol |
| SMILES | Cc1sc(/C=C/c2ccc3cccc(O)c3n2)cc1C1=C(c2cc(CCc3ccc4cccc(O)c4n3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C37H26F6N2O2S2/c1-19-27(17-25(48-19)15-13-23-11-9-21-5-3-7-29(46)33(21)44-23)31-32(36(40,41)37(42,43)35(31,38)39)28-18-26(49-20(28)2)16-14-24-12-10-22-6-4-8-30(47)34(22)45-24/h3-13,15,17-18,46-47H,14,16H2,1-2H3/b15-13+ |
| InChIKey | YFMYZJKYCFUHEK-FYWRMAATSA-N |
| XLogP | 10.72 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.75 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|