C20H22ClNO2S — CID 102525312
(3R,4S)-3-(4-chlorophenyl)-2-cyclohexyl-4-phenylthiazetidine 1,1-dioxide (PubChem CID 102525312) has the molecular formula C20H22ClNO2S and a molecular weight of 375.92 g/mol. Its IUPAC name is (3R,4S)-3-(4-chlorophenyl)-2-cyclohexyl-4-phenylthiazetidine 1,1-dioxide.
| Compound Name | (3R,4S)-3-(4-chlorophenyl)-2-cyclohexyl-4-phenylthiazetidine 1,1-dioxide |
|---|---|
| PubChem CID | 102525312 |
| Molecular Formula | C20H22ClNO2S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (3R,4S)-3-(4-chlorophenyl)-2-cyclohexyl-4-phenylthiazetidine 1,1-dioxide |
| SMILES | O=S1(=O)[C@@H](c2ccccc2)[C@@H](c2ccc(Cl)cc2)N1C1CCCCC1 |
| InChI | InChI=1S/C20H22ClNO2S/c21-17-13-11-15(12-14-17)19-20(16-7-3-1-4-8-16)25(23,24)22(19)18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18-20H,2,5-6,9-10H2/t19-,20+/m1/s1 |
| InChIKey | BELSXJNWNPQTKA-UXHICEINSA-N |
| XLogP | 5.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |