C10H14O3 — CID 102527707
(4aR,8aS)-2,4a-dimethyl-2,3,8,8a-tetrahydro-1,4-benzodioxin-7-one (PubChem CID 102527707) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (4aR,8aS)-2,4a-dimethyl-2,3,8,8a-tetrahydro-1,4-benzodioxin-7-one.
| Compound Name | (4aR,8aS)-2,4a-dimethyl-2,3,8,8a-tetrahydro-1,4-benzodioxin-7-one |
|---|---|
| PubChem CID | 102527707 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (4aR,8aS)-2,4a-dimethyl-2,3,8,8a-tetrahydro-1,4-benzodioxin-7-one |
| SMILES | CC1CO[C@]2(C)C=CC(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C10H14O3/c1-7-6-12-10(2)4-3-8(11)5-9(10)13-7/h3-4,7,9H,5-6H2,1-2H3/t7?,9-,10+/m0/s1 |
| InChIKey | PJCXOWNQEVHNDB-VYDKEIKOSA-N |
| XLogP | 1.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |