C10H10O3 — CID 124706624
(3S)-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione (PubChem CID 124706624) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is (3S)-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione.
| Compound Name | (3S)-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione |
|---|---|
| PubChem CID | 124706624 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | (3S)-3-methyl-3,4-dihydro-1H-isochromene-5,8-dione |
| SMILES | C[C@H]1CC2=C(CO1)C(=O)C=CC2=O |
| InChI | InChI=1S/C10H10O3/c1-6-4-7-8(5-13-6)10(12)3-2-9(7)11/h2-3,6H,4-5H2,1H3/t6-/m0/s1 |
| InChIKey | LNMCLPWJLBLCJR-LURJTMIESA-N |
| XLogP | 0.80 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|