C8H8O2 — CID 139242833
1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-yl)ethanone (PubChem CID 139242833) has the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. Its IUPAC name is 1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-yl)ethanone.
| Compound Name | 1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-yl)ethanone |
|---|---|
| PubChem CID | 139242833 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 1-(7-oxabicyclo[4.1.0]hepta-2,4-dien-2-yl)ethanone |
| SMILES | CC(=O)C1=CC=CC2OC12 |
| InChI | InChI=1S/C8H8O2/c1-5(9)6-3-2-4-7-8(6)10-7/h2-4,7-8H,1H3 |
| InChIKey | MRKKNLLLBQLFNL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|