C25H26FNO6S — CID 102527736
diethyl (2S,5S)-5-ethynyl-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate (PubChem CID 102527736) has the molecular formula C25H26FNO6S and a molecular weight of 487.55 g/mol. Its IUPAC name is diethyl (2S,5S)-5-ethynyl-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate.
| Compound Name | diethyl (2S,5S)-5-ethynyl-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102527736 |
| Molecular Formula | C25H26FNO6S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | diethyl (2S,5S)-5-ethynyl-2-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidine-3,3-dicarboxylate |
| SMILES | C#C[C@@H]1CC(C(=O)OCC)(C(=O)OCC)[C@H](c2ccc(F)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H26FNO6S/c1-5-20-16-25(23(28)32-6-2,24(29)33-7-3)22(18-10-12-19(26)13-11-18)27(20)34(30,31)21-14-8-17(4)9-15-21/h1,8-15,20,22H,6-7,16H2,2-4H3/t20-,22+/m1/s1 |
| InChIKey | YIKZPUWUECAFQB-IRLDBZIGSA-N |
| XLogP | 3.38 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|