C19H30N2O5S — CID 102527887
ethyl 4-(methoxyamino)-4-methyl-1-(4-methylphenyl)sulfonyl-3-propylpyrrolidine-3-carboxylate (PubChem CID 102527887) has the molecular formula C19H30N2O5S and a molecular weight of 398.53 g/mol. Its IUPAC name is ethyl 4-(methoxyamino)-4-methyl-1-(4-methylphenyl)sulfonyl-3-propylpyrrolidine-3-carboxylate.
| Compound Name | ethyl 4-(methoxyamino)-4-methyl-1-(4-methylphenyl)sulfonyl-3-propylpyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 102527887 |
| Molecular Formula | C19H30N2O5S |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | ethyl 4-(methoxyamino)-4-methyl-1-(4-methylphenyl)sulfonyl-3-propylpyrrolidine-3-carboxylate |
| SMILES | CCCC1(C(=O)OCC)CN(S(=O)(=O)c2ccc(C)cc2)CC1(C)NOC |
| InChI | InChI=1S/C19H30N2O5S/c1-6-12-19(17(22)26-7-2)14-21(13-18(19,4)20-25-5)27(23,24)16-10-8-15(3)9-11-16/h8-11,20H,6-7,12-14H2,1-5H3 |
| InChIKey | AWDPMSQYQHNLDR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|