About methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate
methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate (PubChem CID 102528923) has the molecular formula C26H31NO2S
and a molecular weight of 421.61 g/mol. Its IUPAC name is methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate |
| PubChem CID | 102528923 |
| Molecular Formula | C26H31NO2S |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccc(SC)cc2)n(-c2c(C(C)C)cccc2C(C)C)c1C |
| InChI | InChI=1S/C26H31NO2S/c1-16(2)21-9-8-10-22(17(3)4)25(21)27-18(5)23(26(28)29-6)15-24(27)19-11-13-20(30-7)14-12-19/h8-17H,1-7H3 |
| InChIKey | PRLUEYBJPHWAOA-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate?
The IUPAC name of methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate (CID 102528923) is methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate.
What is the SMILES notation for methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate?
The canonical SMILES for methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate is COC(=O)c1cc(-c2ccc(SC)cc2)n(-c2c(C(C)C)cccc2C(C)C)c1C.
What is the InChIKey of methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate?
The InChIKey is PRLUEYBJPHWAOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO2S/c1-16(2)21-9-8-10-22(17(3)4)25(21)27-18(5)23(26(28)29-6)15-24(27)19-11-13-20(30-7)14-12-19/h8-17H,1-7H3.
What are the key properties of methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate?
methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate has a molecular weight of 421.61 g/mol, XLogP of 7.21, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[2,6-di(propan-2-yl)phenyl]-2-methyl-5-(4-methylsulfanylphenyl)pyrrole-3-carboxylate is sourced from PubChem (CID 102528923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).