C19H15N3O2S — CID 917127
methyl 1-(2,1,3-benzothiadiazol-4-yl)-2-methyl-5-phenylpyrrole-3-carboxylate (PubChem CID 917127) has the molecular formula C19H15N3O2S and a molecular weight of 349.42 g/mol. Its IUPAC name is methyl 1-(2,1,3-benzothiadiazol-4-yl)-2-methyl-5-phenylpyrrole-3-carboxylate.
| Compound Name | methyl 1-(2,1,3-benzothiadiazol-4-yl)-2-methyl-5-phenylpyrrole-3-carboxylate |
|---|---|
| PubChem CID | 917127 |
| Molecular Formula | C19H15N3O2S |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | methyl 1-(2,1,3-benzothiadiazol-4-yl)-2-methyl-5-phenylpyrrole-3-carboxylate |
| SMILES | COC(=O)c1cc(-c2ccccc2)n(-c2cccc3nsnc23)c1C |
| InChI | InChI=1S/C19H15N3O2S/c1-12-14(19(23)24-2)11-17(13-7-4-3-5-8-13)22(12)16-10-6-9-15-18(16)21-25-20-15/h3-11H,1-2H3 |
| InChIKey | NJJLNLIKKYVQFZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|