C17H24O6 — CID 102529219
[(1R,3S,6S,7S,10R,11S)-1-hydroxy-6,10-dimethyl-2,5-dioxo-4-oxatricyclo[8.3.1.03,7]tetradecan-11-yl] acetate (PubChem CID 102529219) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(1R,3S,6S,7S,10R,11S)-1-hydroxy-6,10-dimethyl-2,5-dioxo-4-oxatricyclo[8.3.1.03,7]tetradecan-11-yl] acetate.
| Compound Name | [(1R,3S,6S,7S,10R,11S)-1-hydroxy-6,10-dimethyl-2,5-dioxo-4-oxatricyclo[8.3.1.03,7]tetradecan-11-yl] acetate |
|---|---|
| PubChem CID | 102529219 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(1R,3S,6S,7S,10R,11S)-1-hydroxy-6,10-dimethyl-2,5-dioxo-4-oxatricyclo[8.3.1.03,7]tetradecan-11-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(O)C[C@@]1(C)CC[C@H]1[C@H](C)C(=O)O[C@@H]1C2=O |
| InChI | InChI=1S/C17H24O6/c1-9-11-4-6-16(3)8-17(21,7-5-12(16)22-10(2)18)14(19)13(11)23-15(9)20/h9,11-13,21H,4-8H2,1-3H3/t9-,11-,12-,13-,16+,17+/m0/s1 |
| InChIKey | KNDNWCLWDXDPBC-CTLNAQBFSA-N |
| XLogP | 1.38 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |