C26H38O6 — CID 139591713
[(2S,4aR,4bS,6aS,8S,10aR,10bS,11S,12aS)-11-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4-dioxo-5,6,6a,8,9,10,10b,11-octahydro-4aH-naphtho[1,2-h]isochromen-8-yl] acetate (PubChem CID 139591713) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is [(2S,4aR,4bS,6aS,8S,10aR,10bS,11S,12aS)-11-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4-dioxo-5,6,6a,8,9,10,10b,11-octahydro-4aH-naphtho[1,2-h]isochromen-8-yl] acetate.
| Compound Name | [(2S,4aR,4bS,6aS,8S,10aR,10bS,11S,12aS)-11-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4-dioxo-5,6,6a,8,9,10,10b,11-octahydro-4aH-naphtho[1,2-h]isochromen-8-yl] acetate |
|---|---|
| PubChem CID | 139591713 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [(2S,4aR,4bS,6aS,8S,10aR,10bS,11S,12aS)-11-hydroxy-2,4b,7,7,10a,12a-hexamethyl-12-methylidene-1,4-dioxo-5,6,6a,8,9,10,10b,11-octahydro-4aH-naphtho[1,2-h]isochromen-8-yl] acetate |
| SMILES | C=C1[C@@H](O)[C@H]2[C@]3(C)CC[C@H](OC(C)=O)C(C)(C)[C@H]3CC[C@]2(C)[C@H]2C(=O)O[C@@H](C)C(=O)[C@]12C |
| InChI | InChI=1S/C26H38O6/c1-13-18(28)19-24(6)12-10-17(32-15(3)27)23(4,5)16(24)9-11-25(19,7)20-22(30)31-14(2)21(29)26(13,20)8/h14,16-20,28H,1,9-12H2,2-8H3/t14-,16+,17-,18+,19-,20+,24+,25-,26+/m0/s1 |
| InChIKey | DEIJYXBBTBAMIX-WRUUNCBUSA-N |
| XLogP | 3.84 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|