C26H36O8 — CID 93046643
[(1S,2R,3S,8S,10R,11R,12S,15S,17S)-3-hydroxy-2,7,7,11,15,17-hexamethyl-18-methylidene-5,13,16-trioxo-6,14-dioxatetracyclo[9.8.0.02,8.012,17]nonadecan-10-yl] acetate (PubChem CID 93046643) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is [(1S,2R,3S,8S,10R,11R,12S,15S,17S)-3-hydroxy-2,7,7,11,15,17-hexamethyl-18-methylidene-5,13,16-trioxo-6,14-dioxatetracyclo[9.8.0.02,8.012,17]nonadecan-10-yl] acetate.
| Compound Name | [(1S,2R,3S,8S,10R,11R,12S,15S,17S)-3-hydroxy-2,7,7,11,15,17-hexamethyl-18-methylidene-5,13,16-trioxo-6,14-dioxatetracyclo[9.8.0.02,8.012,17]nonadecan-10-yl] acetate |
|---|---|
| PubChem CID | 93046643 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [(1S,2R,3S,8S,10R,11R,12S,15S,17S)-3-hydroxy-2,7,7,11,15,17-hexamethyl-18-methylidene-5,13,16-trioxo-6,14-dioxatetracyclo[9.8.0.02,8.012,17]nonadecan-10-yl] acetate |
| SMILES | C=C1C[C@H]2[C@]3(C)[C@H](C[C@@H](OC(C)=O)[C@@]2(C)[C@@H]2C(=O)O[C@@H](C)C(=O)[C@]12C)C(C)(C)OC(=O)C[C@@H]3O |
| InChI | InChI=1S/C26H36O8/c1-12-9-16-25(7)15(23(4,5)34-19(29)11-17(25)28)10-18(33-14(3)27)26(16,8)20-22(31)32-13(2)21(30)24(12,20)6/h13,15-18,20,28H,1,9-11H2,2-8H3/t13-,15+,16-,17-,18+,20+,24+,25-,26-/m0/s1 |
| InChIKey | CFNGSKADTXWJDG-MZWSWCGWSA-N |
| XLogP | 2.75 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|