C7H6LiNO5S — CID 102529660
lithium 6-(sulfomethyl)pyridine-2-carboxylate (PubChem CID 102529660) has the molecular formula C7H6LiNO5S and a molecular weight of 223.13 g/mol. Its IUPAC name is lithium 6-(sulfomethyl)pyridine-2-carboxylate.
| Compound Name | lithium 6-(sulfomethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 102529660 |
| Molecular Formula | C7H6LiNO5S |
| Molecular Weight | 223.13 g/mol |
| Exact Mass | 223.01 |
| IUPAC Name | lithium 6-(sulfomethyl)pyridine-2-carboxylate |
| SMILES | O=C([O-])c1cccc(CS(=O)(=O)O)n1.[Li+] |
| InChI | InChI=1S/C7H7NO5S.Li/c9-7(10)6-3-1-2-5(8-6)4-14(11,12)13;/h1-3H,4H2,(H,9,10)(H,11,12,13);/q;+1/p-1 |
| InChIKey | PHEVVDMGKNYIRR-UHFFFAOYSA-M |
| XLogP | -4.16 |
| TPSA | 107.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.13 |
| LogP ≤ 5 | -4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|