C7H3CaNO4 — CID 11708274
calcium pyridine-2,6-dicarboxylate (PubChem CID 11708274) has the molecular formula C7H3CaNO4 and a molecular weight of 205.18 g/mol. Its IUPAC name is calcium pyridine-2,6-dicarboxylate.
| Compound Name | calcium pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 11708274 |
| Molecular Formula | C7H3CaNO4 |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 204.97 |
| IUPAC Name | calcium pyridine-2,6-dicarboxylate |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])n1.[Ca+2] |
| InChI | InChI=1S/C7H5NO4.Ca/c9-6(10)4-2-1-3-5(8-4)7(11)12;/h1-3H,(H,9,10)(H,11,12);/q;+2/p-2 |
| InChIKey | WCPGOAHESUQATA-UHFFFAOYSA-L |
| XLogP | -2.57 |
| TPSA | 93.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |