C8H5F3NO3- — CID 140749336
6-(2,2,2-trifluoro-1-hydroxyethyl)pyridine-2-carboxylate (PubChem CID 140749336) has the molecular formula C8H5F3NO3- and a molecular weight of 220.13 g/mol. Its IUPAC name is 6-(2,2,2-trifluoro-1-hydroxyethyl)pyridine-2-carboxylate.
| Compound Name | 6-(2,2,2-trifluoro-1-hydroxyethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 140749336 |
| Molecular Formula | C8H5F3NO3- |
| Molecular Weight | 220.13 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 6-(2,2,2-trifluoro-1-hydroxyethyl)pyridine-2-carboxylate |
| SMILES | O=C([O-])c1cccc(C(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H6F3NO3/c9-8(10,11)6(13)4-2-1-3-5(12-4)7(14)15/h1-3,6,13H,(H,14,15)/p-1 |
| InChIKey | VCBXMBMGYDIHCJ-UHFFFAOYSA-M |
| XLogP | 0.04 |
| TPSA | 73.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.13 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |