C30H31NO3 — CID 102531357
methyl 6-butyl-1-(4-methoxyphenyl)-4,6-diphenylpyridine-3-carboxylate (PubChem CID 102531357) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is methyl 6-butyl-1-(4-methoxyphenyl)-4,6-diphenylpyridine-3-carboxylate.
| Compound Name | methyl 6-butyl-1-(4-methoxyphenyl)-4,6-diphenylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 102531357 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | methyl 6-butyl-1-(4-methoxyphenyl)-4,6-diphenylpyridine-3-carboxylate |
| SMILES | CCCCC1(c2ccccc2)C=C(c2ccccc2)C(C(=O)OC)=CN1c1ccc(OC)cc1 |
| InChI | InChI=1S/C30H31NO3/c1-4-5-20-30(24-14-10-7-11-15-24)21-27(23-12-8-6-9-13-23)28(29(32)34-3)22-31(30)25-16-18-26(33-2)19-17-25/h6-19,21-22H,4-5,20H2,1-3H3 |
| InChIKey | QHQADDGPHYEWSI-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |