C8H15N2O3S+ — CID 102532264
1-(3-methyl-1H-imidazol-3-ium-2-yl)butane-1-sulfonic acid (PubChem CID 102532264) has the molecular formula C8H15N2O3S+ and a molecular weight of 219.29 g/mol. Its IUPAC name is 1-(3-methyl-1H-imidazol-3-ium-2-yl)butane-1-sulfonic acid.
| Compound Name | 1-(3-methyl-1H-imidazol-3-ium-2-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 102532264 |
| Molecular Formula | C8H15N2O3S+ |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-(3-methyl-1H-imidazol-3-ium-2-yl)butane-1-sulfonic acid |
| SMILES | CCCC(c1[nH]cc[n+]1C)S(=O)(=O)O |
| InChI | InChI=1S/C8H14N2O3S/c1-3-4-7(14(11,12)13)8-9-5-6-10(8)2/h5-7H,3-4H2,1-2H3,(H,11,12,13)/p+1 |
| InChIKey | AOKJITQXBAPAJO-UHFFFAOYSA-O |
| XLogP | 0.57 |
| TPSA | 74.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|