C12H21N2O5S+ — CID 141452494
2-methyl-4-[2-(1-sulfobutyl)-1H-imidazol-3-ium-3-yl]butanoic acid (PubChem CID 141452494) has the molecular formula C12H21N2O5S+ and a molecular weight of 305.38 g/mol. Its IUPAC name is 2-methyl-4-[2-(1-sulfobutyl)-1H-imidazol-3-ium-3-yl]butanoic acid.
| Compound Name | 2-methyl-4-[2-(1-sulfobutyl)-1H-imidazol-3-ium-3-yl]butanoic acid |
|---|---|
| PubChem CID | 141452494 |
| Molecular Formula | C12H21N2O5S+ |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-methyl-4-[2-(1-sulfobutyl)-1H-imidazol-3-ium-3-yl]butanoic acid |
| SMILES | CCCC(c1[nH]cc[n+]1CCC(C)C(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C12H20N2O5S/c1-3-4-10(20(17,18)19)11-13-6-8-14(11)7-5-9(2)12(15)16/h6,8-10H,3-5,7H2,1-2H3,(H2,15,16,17,18,19)/p+1 |
| InChIKey | RIPAYPXJFOEBLB-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 111.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|