C16H14FNO5S — CID 102533768
S-(4-methoxyphenyl) (2S,3S)-2-fluoro-3-hydroxy-3-(2-nitrophenyl)propanethioate (PubChem CID 102533768) has the molecular formula C16H14FNO5S and a molecular weight of 351.36 g/mol. Its IUPAC name is S-(4-methoxyphenyl) (2S,3S)-2-fluoro-3-hydroxy-3-(2-nitrophenyl)propanethioate.
| Compound Name | S-(4-methoxyphenyl) (2S,3S)-2-fluoro-3-hydroxy-3-(2-nitrophenyl)propanethioate |
|---|---|
| PubChem CID | 102533768 |
| Molecular Formula | C16H14FNO5S |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | S-(4-methoxyphenyl) (2S,3S)-2-fluoro-3-hydroxy-3-(2-nitrophenyl)propanethioate |
| SMILES | COc1ccc(SC(=O)[C@@H](F)[C@@H](O)c2ccccc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H14FNO5S/c1-23-10-6-8-11(9-7-10)24-16(20)14(17)15(19)12-4-2-3-5-13(12)18(21)22/h2-9,14-15,19H,1H3/t14-,15-/m0/s1 |
| InChIKey | KWLJMXOSBIELQF-GJZGRUSLSA-N |
| XLogP | 3.29 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|