C40H36N2O12 — CID 87702267
[4-[hydroxy-(4-methoxyphenyl)-[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]methyl]phenyl] 2-(2-nitrophenyl)propyl carbonate (PubChem CID 87702267) has the molecular formula C40H36N2O12 and a molecular weight of 736.73 g/mol. Its IUPAC name is [4-[hydroxy-(4-methoxyphenyl)-[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]methyl]phenyl] 2-(2-nitrophenyl)propyl carbonate.
| Compound Name | [4-[hydroxy-(4-methoxyphenyl)-[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]methyl]phenyl] 2-(2-nitrophenyl)propyl carbonate |
|---|---|
| PubChem CID | 87702267 |
| Molecular Formula | C40H36N2O12 |
| Molecular Weight | 736.73 g/mol |
| Exact Mass | 736.23 |
| IUPAC Name | [4-[hydroxy-(4-methoxyphenyl)-[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]methyl]phenyl] 2-(2-nitrophenyl)propyl carbonate |
| SMILES | COc1ccc(C(O)(c2ccc(OC(=O)OCC(C)c3ccccc3[N+](=O)[O-])cc2)c2ccc(OC(=O)OCC(C)c3ccccc3[N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C40H36N2O12/c1-26(34-8-4-6-10-36(34)41(46)47)24-51-38(43)53-32-20-14-29(15-21-32)40(45,28-12-18-31(50-3)19-13-28)30-16-22-33(23-17-30)54-39(44)52-25-27(2)35-9-5-7-11-37(35)42(48)49/h4-23,26-27,45H,24-25H2,1-3H3 |
| InChIKey | CIZZFPPYZKNFHQ-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 186.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.73 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|