About 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride
2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride (PubChem CID 23513296) has the molecular formula C14H16ClN3O4
and a molecular weight of 325.75 g/mol. Its IUPAC name is 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride.
Molecular Properties
| Compound Name | 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride |
| PubChem CID | 23513296 |
| Molecular Formula | C14H16ClN3O4 |
| Molecular Weight | 325.75 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride |
| SMILES | CC(COC(=O)c1[nH]cc[n+]1C)c1ccccc1[N+](=O)[O-].[Cl-] |
| InChI | InChI=1S/C14H15N3O4.ClH/c1-10(11-5-3-4-6-12(11)17(19)20)9-21-14(18)13-15-7-8-16(13)2;/h3-8,10H,9H2,1-2H3;1H |
| InChIKey | RCHQTEDNWSQMFG-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.75 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride?
The IUPAC name of 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride (CID 23513296) is 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride.
What is the SMILES notation for 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride?
The canonical SMILES for 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride is CC(COC(=O)c1[nH]cc[n+]1C)c1ccccc1[N+](=O)[O-].[Cl-].
What is the InChIKey of 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride?
The InChIKey is RCHQTEDNWSQMFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N3O4.ClH/c1-10(11-5-3-4-6-12(11)17(19)20)9-21-14(18)13-15-7-8-16(13)2;/h3-8,10H,9H2,1-2H3;1H.
What are the key properties of 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride?
2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride has a molecular weight of 325.75 g/mol, XLogP of -1.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-nitrophenyl)propyl 3-methyl-1H-imidazol-3-ium-2-carboxylate chloride is sourced from PubChem (CID 23513296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).