About 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate
2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate (PubChem CID 169443741) has the molecular formula C19H21NO7
and a molecular weight of 375.38 g/mol. Its IUPAC name is 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate.
Molecular Properties
| Compound Name | 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate |
| PubChem CID | 169443741 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate |
| SMILES | COc1ccc(C(C)OC(C)COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C19H21NO7/c1-13(26-14(2)15-4-8-17(24-3)9-5-15)12-25-19(21)27-18-10-6-16(7-11-18)20(22)23/h4-11,13-14H,12H2,1-3H3 |
| InChIKey | JBQLSYGLPPMOJN-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate?
The IUPAC name of 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate (CID 169443741) is 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate.
What is the SMILES notation for 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate?
The canonical SMILES for 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate is COc1ccc(C(C)OC(C)COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate?
The InChIKey is JBQLSYGLPPMOJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO7/c1-13(26-14(2)15-4-8-17(24-3)9-5-15)12-25-19(21)27-18-10-6-16(7-11-18)20(22)23/h4-11,13-14H,12H2,1-3H3.
What are the key properties of 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate?
2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate has a molecular weight of 375.38 g/mol, XLogP of 4.29, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4-methoxyphenyl)ethoxy]propyl (4-nitrophenyl) carbonate is sourced from PubChem (CID 169443741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).