C34H36N6O11 — CID 158566993
2-(2-nitrophenyl)propyl N-[2-[2-(2-nitrophenyl)propoxycarbonylamino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]carbamate (PubChem CID 158566993) has the molecular formula C34H36N6O11 and a molecular weight of 704.69 g/mol. Its IUPAC name is 2-(2-nitrophenyl)propyl N-[2-[2-(2-nitrophenyl)propoxycarbonylamino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]carbamate.
| Compound Name | 2-(2-nitrophenyl)propyl N-[2-[2-(2-nitrophenyl)propoxycarbonylamino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 158566993 |
| Molecular Formula | C34H36N6O11 |
| Molecular Weight | 704.69 g/mol |
| Exact Mass | 704.24 |
| IUPAC Name | 2-(2-nitrophenyl)propyl N-[2-[2-(2-nitrophenyl)propoxycarbonylamino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]carbamate |
| SMILES | COc1cc(Cc2cnc(NC(=O)OCC(C)c3ccccc3[N+](=O)[O-])nc2NC(=O)OCC(C)c2ccccc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C34H36N6O11/c1-20(24-10-6-8-12-26(24)39(43)44)18-50-33(41)37-31-23(14-22-15-28(47-3)30(49-5)29(16-22)48-4)17-35-32(36-31)38-34(42)51-19-21(2)25-11-7-9-13-27(25)40(45)46/h6-13,15-17,20-21H,14,18-19H2,1-5H3,(H2,35,36,37,38,41,42) |
| InChIKey | PKRSZOSDHSGJKO-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 216.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.69 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|