C32H38N4O15S4 — CID 71539981
[1-phenyl-3-[[2-[(3-phenyl-1,3-disulfinooxypropyl)amino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]amino]-3-sulfinooxypropyl] hydrogen sulfite (PubChem CID 71539981) has the molecular formula C32H38N4O15S4 and a molecular weight of 846.94 g/mol. Its IUPAC name is [1-phenyl-3-[[2-[(3-phenyl-1,3-disulfinooxypropyl)amino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]amino]-3-sulfinooxypropyl] hydrogen sulfite.
| Compound Name | [1-phenyl-3-[[2-[(3-phenyl-1,3-disulfinooxypropyl)amino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]amino]-3-sulfinooxypropyl] hydrogen sulfite |
|---|---|
| PubChem CID | 71539981 |
| Molecular Formula | C32H38N4O15S4 |
| Molecular Weight | 846.94 g/mol |
| Exact Mass | 846.12 |
| IUPAC Name | [1-phenyl-3-[[2-[(3-phenyl-1,3-disulfinooxypropyl)amino]-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-4-yl]amino]-3-sulfinooxypropyl] hydrogen sulfite |
| SMILES | COc1cc(Cc2cnc(NC(CC(OS(=O)O)c3ccccc3)OS(=O)O)nc2NC(CC(OS(=O)O)c2ccccc2)OS(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C32H38N4O15S4/c1-45-26-15-20(16-27(46-2)30(26)47-3)14-23-19-33-32(35-29(51-55(43)44)18-25(49-53(39)40)22-12-8-5-9-13-22)36-31(23)34-28(50-54(41)42)17-24(48-52(37)38)21-10-6-4-7-11-21/h4-13,15-16,19,24-25,28-29H,14,17-18H2,1-3H3,(H,37,38)(H,39,40)(H,41,42)(H,43,44)(H2,33,34,35,36) |
| InChIKey | QRUBRCCAJIEWNK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 263.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.94 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|