C19H26N4O6 — CID 70591737
N-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]-2-(1-methoxyethoxy)acetamide (PubChem CID 70591737) has the molecular formula C19H26N4O6 and a molecular weight of 406.44 g/mol. Its IUPAC name is N-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]-2-(1-methoxyethoxy)acetamide.
| Compound Name | N-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]-2-(1-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 70591737 |
| Molecular Formula | C19H26N4O6 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]-2-(1-methoxyethoxy)acetamide |
| SMILES | COc1cc(Cc2cnc(NC(=O)COC(C)OC)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C19H26N4O6/c1-11(25-2)29-10-16(24)22-19-21-9-13(18(20)23-19)6-12-7-14(26-3)17(28-5)15(8-12)27-4/h7-9,11H,6,10H2,1-5H3,(H3,20,21,22,23,24) |
| InChIKey | FIDMMIVFBGTFFP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 127.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|