C30H36N4O7 — CID 19024033
[2-[[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 19024033) has the molecular formula C30H36N4O7 and a molecular weight of 564.64 g/mol. Its IUPAC name is [2-[[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 19024033 |
| Molecular Formula | C30H36N4O7 |
| Molecular Weight | 564.64 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | [2-[[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | COc1cc(Cc2cnc(NC(=O)C3(C)CCc4c(C)c(OC(C)=O)c(C)c(C)c4O3)nc2N)cc(OC)c1OC |
| InChI | InChI=1S/C30H36N4O7/c1-15-16(2)25-21(17(3)24(15)40-18(4)35)9-10-30(5,41-25)28(36)34-29-32-14-20(27(31)33-29)11-19-12-22(37-6)26(39-8)23(13-19)38-7/h12-14H,9-11H2,1-8H3,(H3,31,32,33,34,36) |
| InChIKey | SQCSAVOATUBLAU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 144.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.64 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|