C19H27N3O4 — CID 139643249
[2-[(N,N-dimethylcarbamimidoyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate (PubChem CID 139643249) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is [2-[(N,N-dimethylcarbamimidoyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate.
| Compound Name | [2-[(N,N-dimethylcarbamimidoyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
|---|---|
| PubChem CID | 139643249 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | [2-[(N,N-dimethylcarbamimidoyl)carbamoyl]-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-yl] acetate |
| SMILES | [H]/N=C(/NC(=O)C1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1)N(C)C |
| InChI | InChI=1S/C19H27N3O4/c1-10-11(2)16-14(12(3)15(10)25-13(4)23)8-9-19(5,26-16)17(24)21-18(20)22(6)7/h8-9H2,1-7H3,(H2,20,21,24) |
| InChIKey | MLASCZHIKLZKPZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|