C39H34N2O11 — CID 87702237
[3-hydroxy-4-[[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]-phenylmethyl]phenyl] 2-(2-nitrophenyl)propyl carbonate (PubChem CID 87702237) has the molecular formula C39H34N2O11 and a molecular weight of 706.70 g/mol. Its IUPAC name is [3-hydroxy-4-[[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]-phenylmethyl]phenyl] 2-(2-nitrophenyl)propyl carbonate.
| Compound Name | [3-hydroxy-4-[[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]-phenylmethyl]phenyl] 2-(2-nitrophenyl)propyl carbonate |
|---|---|
| PubChem CID | 87702237 |
| Molecular Formula | C39H34N2O11 |
| Molecular Weight | 706.70 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | [3-hydroxy-4-[[4-[2-(2-nitrophenyl)propoxycarbonyloxy]phenyl]-phenylmethyl]phenyl] 2-(2-nitrophenyl)propyl carbonate |
| SMILES | CC(COC(=O)Oc1ccc(C(c2ccccc2)c2ccc(OC(=O)OCC(C)c3ccccc3[N+](=O)[O-])cc2O)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C39H34N2O11/c1-25(31-12-6-8-14-34(31)40(45)46)23-49-38(43)51-29-18-16-28(17-19-29)37(27-10-4-3-5-11-27)33-21-20-30(22-36(33)42)52-39(44)50-24-26(2)32-13-7-9-15-35(32)41(47)48/h3-22,25-26,37,42H,23-24H2,1-2H3 |
| InChIKey | KSMZUOXJDXZJCK-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 177.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.70 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|