C14H21N7 — CID 102536553
N'-(4,6-dimethylpyrimidin-2-yl)-N-[[2-(methylamino)pyrimidin-5-yl]methyl]ethane-1,2-diamine (PubChem CID 102536553) has the molecular formula C14H21N7 and a molecular weight of 287.37 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-N-[[2-(methylamino)pyrimidin-5-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-N-[[2-(methylamino)pyrimidin-5-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 102536553 |
| Molecular Formula | C14H21N7 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-N-[[2-(methylamino)pyrimidin-5-yl]methyl]ethane-1,2-diamine |
| SMILES | CNc1ncc(CNCCNc2nc(C)cc(C)n2)cn1 |
| InChI | InChI=1S/C14H21N7/c1-10-6-11(2)21-14(20-10)17-5-4-16-7-12-8-18-13(15-3)19-9-12/h6,8-9,16H,4-5,7H2,1-3H3,(H,15,18,19)(H,17,20,21) |
| InChIKey | UQAYPDYAEXXYBN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|