C22H20F6N2O3 — CID 10254299
3-[3,5-bis(trifluoromethyl)phenyl]-N-(3-hydroxypropyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 10254299) has the molecular formula C22H20F6N2O3 and a molecular weight of 474.40 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-N-(3-hydroxypropyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-(3-hydroxypropyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 10254299 |
| Molecular Formula | C22H20F6N2O3 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-(3-hydroxypropyl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | CN1C(=O)c2ccccc2C(C(=O)NCCCO)C1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H20F6N2O3/c1-30-18(12-9-13(21(23,24)25)11-14(10-12)22(26,27)28)17(19(32)29-7-4-8-31)15-5-2-3-6-16(15)20(30)33/h2-3,5-6,9-11,17-18,31H,4,7-8H2,1H3,(H,29,32) |
| InChIKey | MTWIRTDTLOJREP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|