C24H19F6N5O2 — CID 87989246
(3S,4S)-3-[3,5-bis(trifluoromethyl)phenyl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 87989246) has the molecular formula C24H19F6N5O2 and a molecular weight of 523.44 g/mol. Its IUPAC name is (3S,4S)-3-[3,5-bis(trifluoromethyl)phenyl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4S)-3-[3,5-bis(trifluoromethyl)phenyl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 87989246 |
| Molecular Formula | C24H19F6N5O2 |
| Molecular Weight | 523.44 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | (3S,4S)-3-[3,5-bis(trifluoromethyl)phenyl]-N-(5,6-dimethyl-1,2,4-triazin-3-yl)-2-methyl-1-oxo-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | Cc1nnc(NC(=O)[C@H]2c3ccccc3C(=O)N(C)[C@@H]2c2cc(C(F)(F)F)cc(C(F)(F)F)c2)nc1C |
| InChI | InChI=1S/C24H19F6N5O2/c1-11-12(2)33-34-22(31-11)32-20(36)18-16-6-4-5-7-17(16)21(37)35(3)19(18)13-8-14(23(25,26)27)10-15(9-13)24(28,29)30/h4-10,18-19H,1-3H3,(H,31,32,34,36)/t18-,19+/m0/s1 |
| InChIKey | XPYKRJUPCSEJIK-RBUKOAKNSA-N |
| XLogP | 5.08 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |