C24H15N3O2S — CID 102552150
5',6'-diphenylspiro[1H-indole-3,2'-imidazo[2,1-b][1,3]thiazole]-2,3'-dione (PubChem CID 102552150) has the molecular formula C24H15N3O2S and a molecular weight of 409.47 g/mol. Its IUPAC name is 5',6'-diphenylspiro[1H-indole-3,2'-imidazo[2,1-b][1,3]thiazole]-2,3'-dione.
| Compound Name | 5',6'-diphenylspiro[1H-indole-3,2'-imidazo[2,1-b][1,3]thiazole]-2,3'-dione |
|---|---|
| PubChem CID | 102552150 |
| Molecular Formula | C24H15N3O2S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | 5',6'-diphenylspiro[1H-indole-3,2'-imidazo[2,1-b][1,3]thiazole]-2,3'-dione |
| SMILES | O=C1Nc2ccccc2C12Sc1nc(-c3ccccc3)c(-c3ccccc3)n1C2=O |
| InChI | InChI=1S/C24H15N3O2S/c28-21-24(17-13-7-8-14-18(17)25-21)22(29)27-20(16-11-5-2-6-12-16)19(26-23(27)30-24)15-9-3-1-4-10-15/h1-14H,(H,25,28) |
| InChIKey | JDCSZURHDZSZFO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|