C17H19N3O5 — CID 102555785
[2-(1,3-dioxolan-2-yl)piperidin-1-yl]-(7-nitro-1H-indol-2-yl)methanone (PubChem CID 102555785) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is [2-(1,3-dioxolan-2-yl)piperidin-1-yl]-(7-nitro-1H-indol-2-yl)methanone.
| Compound Name | [2-(1,3-dioxolan-2-yl)piperidin-1-yl]-(7-nitro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 102555785 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | [2-(1,3-dioxolan-2-yl)piperidin-1-yl]-(7-nitro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2cccc([N+](=O)[O-])c2[nH]1)N1CCCCC1C1OCCO1 |
| InChI | InChI=1S/C17H19N3O5/c21-16(19-7-2-1-5-14(19)17-24-8-9-25-17)12-10-11-4-3-6-13(20(22)23)15(11)18-12/h3-4,6,10,14,17-18H,1-2,5,7-9H2 |
| InChIKey | GOQZVNIFONOFMS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|