C16H17N3O5 — CID 51085910
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(7-nitro-1H-indol-2-yl)methanone (PubChem CID 51085910) has the molecular formula C16H17N3O5 and a molecular weight of 331.33 g/mol. Its IUPAC name is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(7-nitro-1H-indol-2-yl)methanone.
| Compound Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(7-nitro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 51085910 |
| Molecular Formula | C16H17N3O5 |
| Molecular Weight | 331.33 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-(7-nitro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2cccc([N+](=O)[O-])c2[nH]1)N1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H17N3O5/c20-15(18-6-4-16(5-7-18)23-8-9-24-16)12-10-11-2-1-3-13(19(21)22)14(11)17-12/h1-3,10,17H,4-9H2 |
| InChIKey | WYKOVNVFFPOEOH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|