C16H17N3O6 — CID 120542786
4-[[(7-nitro-1H-indole-2-carbonyl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 120542786) has the molecular formula C16H17N3O6 and a molecular weight of 347.33 g/mol. Its IUPAC name is 4-[[(7-nitro-1H-indole-2-carbonyl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(7-nitro-1H-indole-2-carbonyl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542786 |
| Molecular Formula | C16H17N3O6 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 4-[[(7-nitro-1H-indole-2-carbonyl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCOCC1)c1cc2cccc([N+](=O)[O-])c2[nH]1 |
| InChI | InChI=1S/C16H17N3O6/c20-14(17-9-16(15(21)22)4-6-25-7-5-16)11-8-10-2-1-3-12(19(23)24)13(10)18-11/h1-3,8,18H,4-7,9H2,(H,17,20)(H,21,22) |
| InChIKey | OHJPUQQNKOLXEN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 134.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|