C16H20N2O8 — CID 120542058
4-[[(4,5-dimethoxy-2-nitrobenzoyl)amino]methyl]oxane-4-carboxylic acid (PubChem CID 120542058) has the molecular formula C16H20N2O8 and a molecular weight of 368.34 g/mol. Its IUPAC name is 4-[[(4,5-dimethoxy-2-nitrobenzoyl)amino]methyl]oxane-4-carboxylic acid.
| Compound Name | 4-[[(4,5-dimethoxy-2-nitrobenzoyl)amino]methyl]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 120542058 |
| Molecular Formula | C16H20N2O8 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 4-[[(4,5-dimethoxy-2-nitrobenzoyl)amino]methyl]oxane-4-carboxylic acid |
| SMILES | COc1cc(C(=O)NCC2(C(=O)O)CCOCC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C16H20N2O8/c1-24-12-7-10(11(18(22)23)8-13(12)25-2)14(19)17-9-16(15(20)21)3-5-26-6-4-16/h7-8H,3-6,9H2,1-2H3,(H,17,19)(H,20,21) |
| InChIKey | ITTHJNIHBKRKNE-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|