C15H18N2O4S — CID 102559766
N-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 102559766) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is N-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 102559766 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | N-[[3-(2-hydroxyethyl)oxolan-3-yl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | O=C(NCC1(CCO)CCOC1)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C15H18N2O4S/c18-5-3-15(4-6-20-9-15)8-16-13(19)10-1-2-11-12(7-10)21-14(22)17-11/h1-2,7,18H,3-6,8-9H2,(H,16,19)(H,17,22) |
| InChIKey | KAYPSGMLAXHQNZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|