C14H14N2O4S — CID 99564751
cyclopropylmethyl 2-[(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate (PubChem CID 99564751) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is cyclopropylmethyl 2-[(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate.
| Compound Name | cyclopropylmethyl 2-[(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 99564751 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | cyclopropylmethyl 2-[(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1ccc2[nH]c(=S)oc2c1)OCC1CC1 |
| InChI | InChI=1S/C14H14N2O4S/c17-12(19-7-8-1-2-8)6-15-13(18)9-3-4-10-11(5-9)20-14(21)16-10/h3-5,8H,1-2,6-7H2,(H,15,18)(H,16,21) |
| InChIKey | JUXINDMUQOPXIU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|