C14H14N2O6S — CID 99809336
methyl 2-[(2-methoxy-2-oxoethyl)-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate (PubChem CID 99809336) has the molecular formula C14H14N2O6S and a molecular weight of 338.34 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 99809336 |
| Molecular Formula | C14H14N2O6S |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)C(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C14H14N2O6S/c1-20-11(17)6-16(7-12(18)21-2)13(19)8-3-4-9-10(5-8)22-14(23)15-9/h3-5H,6-7H2,1-2H3,(H,15,23) |
| InChIKey | BAQTVPFKCVWJET-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 101.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|