C14H12N4O2S — CID 96568436
N,N-bis(2-cyanoethyl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 96568436) has the molecular formula C14H12N4O2S and a molecular weight of 300.34 g/mol. Its IUPAC name is N,N-bis(2-cyanoethyl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N,N-bis(2-cyanoethyl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 96568436 |
| Molecular Formula | C14H12N4O2S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | N,N-bis(2-cyanoethyl)-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | N#CCCN(CCC#N)C(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C14H12N4O2S/c15-5-1-7-18(8-2-6-16)13(19)10-3-4-11-12(9-10)20-14(21)17-11/h3-4,9H,1-2,7-8H2,(H,17,21) |
| InChIKey | VTDJYEJNVIZVSR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 96.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|