C17H16N2O3S2 — CID 99814312
N-methyl-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 99814312) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is N-methyl-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-methyl-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 99814312 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | N-methyl-N-[[4-[(R)-methylsulfinyl]phenyl]methyl]-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | CN(Cc1ccc([S@@](C)=O)cc1)C(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-19(10-11-3-6-13(7-4-11)24(2)21)16(20)12-5-8-14-15(9-12)22-17(23)18-14/h3-9H,10H2,1-2H3,(H,18,23)/t24-/m1/s1 |
| InChIKey | RSMBIPWNYADDNF-XMMPIXPASA-N |
| XLogP | 3.50 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|