C16H12N2O4S — CID 99714193
N-(1,3-benzodioxol-5-yl)-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide (PubChem CID 99714193) has the molecular formula C16H12N2O4S and a molecular weight of 328.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
|---|---|
| PubChem CID | 99714193 |
| Molecular Formula | C16H12N2O4S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N-methyl-2-sulfanylidene-3H-1,3-benzoxazole-6-carboxamide |
| SMILES | CN(C(=O)c1ccc2[nH]c(=S)oc2c1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H12N2O4S/c1-18(10-3-5-12-14(7-10)21-8-20-12)15(19)9-2-4-11-13(6-9)22-16(23)17-11/h2-7H,8H2,1H3,(H,17,23) |
| InChIKey | DEKDYVYPXNBNOC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|