C18H23N3O3 — CID 102560661
2-cyano-N-cyclohexyl-3-oxo-3-(6-propan-2-yloxy-2-pyridinyl)propanamide (PubChem CID 102560661) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-cyano-N-cyclohexyl-3-oxo-3-(6-propan-2-yloxy-2-pyridinyl)propanamide.
| Compound Name | 2-cyano-N-cyclohexyl-3-oxo-3-(6-propan-2-yloxy-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 102560661 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 2-cyano-N-cyclohexyl-3-oxo-3-(6-propan-2-yloxy-2-pyridinyl)propanamide |
| SMILES | CC(C)Oc1cccc(C(=O)C(C#N)C(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C18H23N3O3/c1-12(2)24-16-10-6-9-15(21-16)17(22)14(11-19)18(23)20-13-7-4-3-5-8-13/h6,9-10,12-14H,3-5,7-8H2,1-2H3,(H,20,23) |
| InChIKey | ZYJAWQWGOWJFOR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|