C17H22N4O2S — CID 102560928
N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]-3-(oxan-2-yl)propanamide (PubChem CID 102560928) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]-3-(oxan-2-yl)propanamide.
| Compound Name | N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]-3-(oxan-2-yl)propanamide |
|---|---|
| PubChem CID | 102560928 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]-3-(oxan-2-yl)propanamide |
| SMILES | Cc1n[nH]c(=S)n1-c1cccc(NC(=O)CCC2CCCCO2)c1 |
| InChI | InChI=1S/C17H22N4O2S/c1-12-19-20-17(24)21(12)14-6-4-5-13(11-14)18-16(22)9-8-15-7-2-3-10-23-15/h4-6,11,15H,2-3,7-10H2,1H3,(H,18,22)(H,20,24) |
| InChIKey | WOMUYUMBSBPAMN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|