C18H20N4OS — CID 100638869
(1S,2S,4S,5S)-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]tricyclo[3.2.1.02,4]octane-3-carboxamide (PubChem CID 100638869) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is (1S,2S,4S,5S)-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]tricyclo[3.2.1.02,4]octane-3-carboxamide.
| Compound Name | (1S,2S,4S,5S)-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]tricyclo[3.2.1.02,4]octane-3-carboxamide |
|---|---|
| PubChem CID | 100638869 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (1S,2S,4S,5S)-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]tricyclo[3.2.1.02,4]octane-3-carboxamide |
| SMILES | Cc1n[nH]c(=S)n1-c1cccc(NC(=O)C2[C@H]3[C@H]4CC[C@@H](C4)[C@H]23)c1 |
| InChI | InChI=1S/C18H20N4OS/c1-9-20-21-18(24)22(9)13-4-2-3-12(8-13)19-17(23)16-14-10-5-6-11(7-10)15(14)16/h2-4,8,10-11,14-16H,5-7H2,1H3,(H,19,23)(H,21,24)/t10-,11-,14-,15-/m0/s1 |
| InChIKey | WFDCGLBFFCZKBD-GVARAGBVSA-N |
| XLogP | 3.47 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|