C18H24N4O2S — CID 99705166
2-[(1S,2R)-2-methylcyclohexyl]oxy-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]acetamide (PubChem CID 99705166) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-[(1S,2R)-2-methylcyclohexyl]oxy-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]acetamide.
| Compound Name | 2-[(1S,2R)-2-methylcyclohexyl]oxy-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 99705166 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 2-[(1S,2R)-2-methylcyclohexyl]oxy-N-[3-(3-methyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)phenyl]acetamide |
| SMILES | Cc1n[nH]c(=S)n1-c1cccc(NC(=O)CO[C@H]2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C18H24N4O2S/c1-12-6-3-4-9-16(12)24-11-17(23)19-14-7-5-8-15(10-14)22-13(2)20-21-18(22)25/h5,7-8,10,12,16H,3-4,6,9,11H2,1-2H3,(H,19,23)(H,21,25)/t12-,16+/m1/s1 |
| InChIKey | BMZWNOSUKWXZPS-WBMJQRKESA-N |
| XLogP | 3.77 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|