C15H14N4O3S — CID 102561331
5-(oxolan-2-yl)-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-1,3-oxazole-4-carboxamide (PubChem CID 102561331) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 5-(oxolan-2-yl)-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(oxolan-2-yl)-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 102561331 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 5-(oxolan-2-yl)-N-(2-sulfanylidene-1,3-dihydrobenzimidazol-5-yl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(Nc1ccc2[nH]c(=S)[nH]c2c1)c1ncoc1C1CCCO1 |
| InChI | InChI=1S/C15H14N4O3S/c20-14(12-13(22-7-16-12)11-2-1-5-21-11)17-8-3-4-9-10(6-8)19-15(23)18-9/h3-4,6-7,11H,1-2,5H2,(H,17,20)(H2,18,19,23) |
| InChIKey | AASUVZHMBYIDLN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|