C26H23ClN2O6S — CID 10256346
5-butanoyl-2-[[4-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]benzoic acid (PubChem CID 10256346) has the molecular formula C26H23ClN2O6S and a molecular weight of 527.00 g/mol. Its IUPAC name is 5-butanoyl-2-[[4-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]benzoic acid.
| Compound Name | 5-butanoyl-2-[[4-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 10256346 |
| Molecular Formula | C26H23ClN2O6S |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.10 |
| IUPAC Name | 5-butanoyl-2-[[4-[(6-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]benzoic acid |
| SMILES | CCCC(=O)c1ccc(NC(=O)c2ccc(S(=O)(=O)N3CCc4ccc(Cl)cc43)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C26H23ClN2O6S/c1-2-3-24(30)18-7-11-22(21(14-18)26(32)33)28-25(31)17-5-9-20(10-6-17)36(34,35)29-13-12-16-4-8-19(27)15-23(16)29/h4-11,14-15H,2-3,12-13H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | PXGQFXFHYLKCPE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |