C23H18ClN3O6S — CID 131738048
2-[[3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(Z)-hydroxyiminomethyl]benzoic acid (PubChem CID 131738048) has the molecular formula C23H18ClN3O6S and a molecular weight of 499.93 g/mol. Its IUPAC name is 2-[[3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(Z)-hydroxyiminomethyl]benzoic acid.
| Compound Name | 2-[[3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(Z)-hydroxyiminomethyl]benzoic acid |
|---|---|
| PubChem CID | 131738048 |
| Molecular Formula | C23H18ClN3O6S |
| Molecular Weight | 499.93 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 2-[[3-[(5-chloro-2,3-dihydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(Z)-hydroxyiminomethyl]benzoic acid |
| SMILES | O=C(Nc1ccc(/C=N\O)cc1C(=O)O)c1cccc(S(=O)(=O)N2CCc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C23H18ClN3O6S/c24-17-5-7-21-15(11-17)8-9-27(21)34(32,33)18-3-1-2-16(12-18)22(28)26-20-6-4-14(13-25-31)10-19(20)23(29)30/h1-7,10-13,31H,8-9H2,(H,26,28)(H,29,30)/b25-13- |
| InChIKey | JMWJWZXHOUCVFI-MXAYSNPKSA-N |
| XLogP | 3.85 |
| TPSA | 136.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.93 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|