C26H26ClN3O6S — CID 142865652
methyl 2-[[3-[(5-chloro-7-methyl-2,3,6,7-tetrahydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(E)-methoxyiminomethyl]benzoate (PubChem CID 142865652) has the molecular formula C26H26ClN3O6S and a molecular weight of 544.03 g/mol. Its IUPAC name is methyl 2-[[3-[(5-chloro-7-methyl-2,3,6,7-tetrahydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(E)-methoxyiminomethyl]benzoate.
| Compound Name | methyl 2-[[3-[(5-chloro-7-methyl-2,3,6,7-tetrahydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(E)-methoxyiminomethyl]benzoate |
|---|---|
| PubChem CID | 142865652 |
| Molecular Formula | C26H26ClN3O6S |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.12 |
| IUPAC Name | methyl 2-[[3-[(5-chloro-7-methyl-2,3,6,7-tetrahydroindol-1-yl)sulfonyl]benzoyl]amino]-5-[(E)-methoxyiminomethyl]benzoate |
| SMILES | CO/N=C/c1ccc(NC(=O)c2cccc(S(=O)(=O)N3CCC4=C3C(C)CC(Cl)=C4)c2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C26H26ClN3O6S/c1-16-11-20(27)13-18-9-10-30(24(16)18)37(33,34)21-6-4-5-19(14-21)25(31)29-23-8-7-17(15-28-36-3)12-22(23)26(32)35-2/h4-8,12-16H,9-11H2,1-3H3,(H,29,31)/b28-15+ |
| InChIKey | RGDYIOHNFSEKIL-RWPZCVJISA-N |
| XLogP | 4.52 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|